C64H48N4O2Si — CID 171057267
9-(4-tert-butyl-2-pyridinyl)-2-[6-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]benzo[d][1,3,2]benzodioxasilepin-6-yl]carbazole (PubChem CID 171057267) has the molecular formula C64H48N4O2Si and a molecular weight of 933.20 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[6-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]benzo[d][1,3,2]benzodioxasilepin-6-yl]carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[6-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]benzo[d][1,3,2]benzodioxasilepin-6-yl]carbazole |
|---|---|
| PubChem CID | 171057267 |
| Molecular Formula | C64H48N4O2Si |
| Molecular Weight | 933.20 g/mol |
| Exact Mass | 932.35 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[6-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]benzo[d][1,3,2]benzodioxasilepin-6-yl]carbazole |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc([Si]4(c5cccc(-n6[c-][n+](-c7c(-c8ccccc8)cccc7-c7ccccc7)c7ccccc76)c5)Oc5ccccc5-c5ccccc5O4)cc32)c1 |
| InChI | InChI=1S/C64H48N4O2Si/c1-64(2,3)46-38-39-65-62(40-46)68-56-31-13-10-26-52(56)53-37-36-49(42-59(53)68)71(69-60-34-16-11-27-54(60)55-28-12-17-35-61(55)70-71)48-25-18-24-47(41-48)66-43-67(58-33-15-14-32-57(58)66)63-50(44-20-6-4-7-21-44)29-19-30-51(63)45-22-8-5-9-23-45/h4-42H,1-3H3 |
| InChIKey | YQZMMQXRILCOFT-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.20 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|