C59H52N4O — CID 171415928
6-[2-[[3-[3-[2-(2-tert-butylphenyl)-6-(4-tert-butylphenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]methyl]carbazol-9-yl]-1,3-dihydrofuro[3,4-c]pyridine (PubChem CID 171415928) has the molecular formula C59H52N4O and a molecular weight of 833.09 g/mol. Its IUPAC name is 6-[2-[[3-[3-[2-(2-tert-butylphenyl)-6-(4-tert-butylphenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]methyl]carbazol-9-yl]-1,3-dihydrofuro[3,4-c]pyridine.
| Compound Name | 6-[2-[[3-[3-[2-(2-tert-butylphenyl)-6-(4-tert-butylphenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]methyl]carbazol-9-yl]-1,3-dihydrofuro[3,4-c]pyridine |
|---|---|
| PubChem CID | 171415928 |
| Molecular Formula | C59H52N4O |
| Molecular Weight | 833.09 g/mol |
| Exact Mass | 832.41 |
| IUPAC Name | 6-[2-[[3-[3-[2-(2-tert-butylphenyl)-6-(4-tert-butylphenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]methyl]carbazol-9-yl]-1,3-dihydrofuro[3,4-c]pyridine |
| SMILES | CC(C)(C)c1ccc(-c2cccc(-c3ccccc3C(C)(C)C)c2-[n+]2[c-]n(-c3cccc(Cc4ccc5c6ccccc6n(-c6cc7c(cn6)COC7)c5c4)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C59H52N4O/c1-58(2,3)44-28-26-41(27-29-44)46-19-14-20-50(47-17-7-9-21-51(47)59(4,5)6)57(46)62-38-61(53-23-11-12-24-54(53)62)45-16-13-15-39(32-45)31-40-25-30-49-48-18-8-10-22-52(48)63(55(49)33-40)56-34-42-36-64-37-43(42)35-60-56/h7-30,32-35H,31,36-37H2,1-6H3 |
| InChIKey | AIDWBHHVDIJSST-UHFFFAOYSA-N |
| XLogP | 13.75 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.09 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|