C57H48N4O — CID 171416092
6-[2-[[3-[3-[2-(2-tert-butylphenyl)-6-phenylphenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]methyl]carbazol-9-yl]-1,1-dimethyl-3H-furo[3,4-c]pyridine (PubChem CID 171416092) has the molecular formula C57H48N4O and a molecular weight of 805.04 g/mol. Its IUPAC name is 6-[2-[[3-[3-[2-(2-tert-butylphenyl)-6-phenylphenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]methyl]carbazol-9-yl]-1,1-dimethyl-3H-furo[3,4-c]pyridine.
| Compound Name | 6-[2-[[3-[3-[2-(2-tert-butylphenyl)-6-phenylphenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]methyl]carbazol-9-yl]-1,1-dimethyl-3H-furo[3,4-c]pyridine |
|---|---|
| PubChem CID | 171416092 |
| Molecular Formula | C57H48N4O |
| Molecular Weight | 805.04 g/mol |
| Exact Mass | 804.38 |
| IUPAC Name | 6-[2-[[3-[3-[2-(2-tert-butylphenyl)-6-phenylphenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]methyl]carbazol-9-yl]-1,1-dimethyl-3H-furo[3,4-c]pyridine |
| SMILES | CC(C)(C)c1ccccc1-c1cccc(-c2ccccc2)c1-[n+]1[c-]n(-c2cccc(Cc3ccc4c5ccccc5n(-c5cc6c(cn5)COC6(C)C)c4c3)c2)c2ccccc21 |
| InChI | InChI=1S/C57H48N4O/c1-56(2,3)48-25-11-9-21-44(48)47-24-16-23-43(40-18-7-6-8-19-40)55(47)60-37-59(51-27-13-14-28-52(51)60)42-20-15-17-38(32-42)31-39-29-30-46-45-22-10-12-26-50(45)61(53(46)33-39)54-34-49-41(35-58-54)36-62-57(49,4)5/h6-30,32-35H,31,36H2,1-5H3 |
| InChIKey | NHOPVGYACZIOKQ-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.04 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|