C52H44N5O+ — CID 171415898
1-[2-[[3-[3-(3,5-ditert-butylphenyl)benzimidazol-1-ium-1-yl]phenyl]methyl]carbazol-9-yl]-[1]benzofuro[3,2-c]pyridine-6-carbonitrile (PubChem CID 171415898) has the molecular formula C52H44N5O+ and a molecular weight of 754.96 g/mol. Its IUPAC name is 1-[2-[[3-[3-(3,5-ditert-butylphenyl)benzimidazol-1-ium-1-yl]phenyl]methyl]carbazol-9-yl]-[1]benzofuro[3,2-c]pyridine-6-carbonitrile.
| Compound Name | 1-[2-[[3-[3-(3,5-ditert-butylphenyl)benzimidazol-1-ium-1-yl]phenyl]methyl]carbazol-9-yl]-[1]benzofuro[3,2-c]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 171415898 |
| Molecular Formula | C52H44N5O+ |
| Molecular Weight | 754.96 g/mol |
| Exact Mass | 754.35 |
| IUPAC Name | 1-[2-[[3-[3-(3,5-ditert-butylphenyl)benzimidazol-1-ium-1-yl]phenyl]methyl]carbazol-9-yl]-[1]benzofuro[3,2-c]pyridine-6-carbonitrile |
| SMILES | CC(C)(C)c1cc(-n2c[n+](-c3cccc(Cc4ccc5c6ccccc6n(-c6nccc7oc8c(C#N)cccc8c67)c5c4)c3)c3ccccc32)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C52H44N5O/c1-51(2,3)36-28-37(52(4,5)6)30-39(29-36)56-32-55(44-19-9-10-20-45(44)56)38-15-11-13-33(26-38)25-34-21-22-41-40-16-7-8-18-43(40)57(46(41)27-34)50-48-42-17-12-14-35(31-53)49(42)58-47(48)23-24-54-50/h7-24,26-30,32H,25H2,1-6H3/q+1 |
| InChIKey | YWKUHGARNABTCU-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 63.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.96 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|