C48H34N2Pt — CID 166586944
platinum(4+);8,8,14,14-tetramethyl-N,N-bis(3-phenylbenzene-2-id-1-yl)-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-amine (PubChem CID 166586944) has the molecular formula C48H34N2Pt and a molecular weight of 833.89 g/mol. Its IUPAC name is platinum(4+);8,8,14,14-tetramethyl-N,N-bis(3-phenylbenzene-2-id-1-yl)-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-amine.
| Compound Name | platinum(4+);8,8,14,14-tetramethyl-N,N-bis(3-phenylbenzene-2-id-1-yl)-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-amine |
|---|---|
| PubChem CID | 166586944 |
| Molecular Formula | C48H34N2Pt |
| Molecular Weight | 833.89 g/mol |
| Exact Mass | 833.24 |
| IUPAC Name | platinum(4+);8,8,14,14-tetramethyl-N,N-bis(3-phenylbenzene-2-id-1-yl)-1-azahexacyclo[11.7.1.02,7.03,19.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-amine |
| SMILES | CC1(C)c2cc(N(c3[c-]c(-c4[c-]cccc4)ccc3)c3[c-]c(-c4[c-]cccc4)ccc3)cc3c2-n2c4c1cccc4c1cccc(c12)C3(C)C.[Pt+4] |
| InChI | InChI=1S/C48H34N2.Pt/c1-47(2)40-25-13-23-38-39-24-14-26-41-45(39)50(44(38)40)46-42(47)29-37(30-43(46)48(41,3)4)49(35-21-11-19-33(27-35)31-15-7-5-8-16-31)36-22-12-20-34(28-36)32-17-9-6-10-18-32;/h5-15,17,19-26,29-30H,1-4H3;/q-4;+4 |
| InChIKey | WLVHOBYLEHFPBE-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.89 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|