C40H26BN4Pt — CID 161022211
CID 161022211 (PubChem CID 161022211) has the molecular formula C40H26BN4Pt and a molecular weight of 768.57 g/mol.
| Compound Name | CID 161022211 |
|---|---|
| PubChem CID | 161022211 |
| Molecular Formula | C40H26BN4Pt |
| Molecular Weight | 768.57 g/mol |
| Exact Mass | 768.19 |
| IUPAC Name | — |
| SMILES | [B].[Pt+2].[c-]1c(-c2ccccn2)cccc1N(c1[c-]c(-c2ccccn2)ccc1)c1ccc(-n2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C40H26N4.B.Pt/c1-3-19-39-35(15-1)36-16-2-4-20-40(36)44(39)32-23-21-31(22-24-32)43(33-13-9-11-29(27-33)37-17-5-7-25-41-37)34-14-10-12-30(28-34)38-18-6-8-26-42-38;;/h1-26H;;/q-2;;+2 |
| InChIKey | MXMPHMULHCVMQK-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.57 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|