C49H48N3OPt- — CID 159267999
2-[4-(3,5-ditert-butylphenyl)-6-[3-(2-phenyl-N-pyridin-2-ylanilino)benzene-2-id-1-yl]-2-pyridinyl]phenol;methane;platinum (PubChem CID 159267999) has the molecular formula C49H48N3OPt- and a molecular weight of 890.02 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-[3-(2-phenyl-N-pyridin-2-ylanilino)benzene-2-id-1-yl]-2-pyridinyl]phenol;methane;platinum.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-(2-phenyl-N-pyridin-2-ylanilino)benzene-2-id-1-yl]-2-pyridinyl]phenol;methane;platinum |
|---|---|
| PubChem CID | 159267999 |
| Molecular Formula | C49H48N3OPt- |
| Molecular Weight | 890.02 g/mol |
| Exact Mass | 889.35 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-(2-phenyl-N-pyridin-2-ylanilino)benzene-2-id-1-yl]-2-pyridinyl]phenol;methane;platinum |
| SMILES | C.CC(C)(C)c1cc(-c2cc(-c3[c-]c(N(c4ccccn4)c4ccccc4-c4ccccc4)ccc3)nc(-c3ccccc3O)c2)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C48H44N3O.CH4.Pt/c1-47(2,3)37-27-35(28-38(32-37)48(4,5)6)36-30-42(50-43(31-36)41-22-11-13-24-45(41)52)34-19-16-20-39(29-34)51(46-25-14-15-26-49-46)44-23-12-10-21-40(44)33-17-8-7-9-18-33;;/h7-28,30-32,52H,1-6H3;1H4;/q-1;; |
| InChIKey | GXXRRONEFQTILM-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.02 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|