C54H40N3OPt- — CID 164742031
2-[6-[3-(2,6-diphenyl-N-pyridin-2-ylanilino)-5-(1-phenylethyl)benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum (PubChem CID 164742031) has the molecular formula C54H40N3OPt- and a molecular weight of 942.01 g/mol. Its IUPAC name is 2-[6-[3-(2,6-diphenyl-N-pyridin-2-ylanilino)-5-(1-phenylethyl)benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[6-[3-(2,6-diphenyl-N-pyridin-2-ylanilino)-5-(1-phenylethyl)benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 164742031 |
| Molecular Formula | C54H40N3OPt- |
| Molecular Weight | 942.01 g/mol |
| Exact Mass | 941.28 |
| IUPAC Name | 2-[6-[3-(2,6-diphenyl-N-pyridin-2-ylanilino)-5-(1-phenylethyl)benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum |
| SMILES | CC(c1ccccc1)c1cc(-c2cc(-c3ccccc3)cc(-c3ccccc3O)n2)[c-]c(N(c2ccccn2)c2c(-c3ccccc3)cccc2-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C54H40N3O.Pt/c1-38(39-19-6-2-7-20-39)43-33-45(50-36-44(40-21-8-3-9-22-40)37-51(56-50)49-27-14-15-30-52(49)58)35-46(34-43)57(53-31-16-17-32-55-53)54-47(41-23-10-4-11-24-41)28-18-29-48(54)42-25-12-5-13-26-42;/h2-34,36-38,58H,1H3;/q-1; |
| InChIKey | QYSCAEAJMKJLJW-UHFFFAOYSA-N |
| XLogP | 13.94 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.01 |
| LogP ≤ 5 | 13.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|