C44H30N3OPt- — CID 153304079
2-[6-[3-[naphthalen-1-yl-(4-phenyl-2-pyridinyl)amino]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum (PubChem CID 153304079) has the molecular formula C44H30N3OPt- and a molecular weight of 811.82 g/mol. Its IUPAC name is 2-[6-[3-[naphthalen-1-yl-(4-phenyl-2-pyridinyl)amino]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[6-[3-[naphthalen-1-yl-(4-phenyl-2-pyridinyl)amino]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 153304079 |
| Molecular Formula | C44H30N3OPt- |
| Molecular Weight | 811.82 g/mol |
| Exact Mass | 811.20 |
| IUPAC Name | 2-[6-[3-[naphthalen-1-yl-(4-phenyl-2-pyridinyl)amino]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum |
| SMILES | Oc1ccccc1-c1cc(-c2ccccc2)cc(-c2[c-]c(N(c3cc(-c4ccccc4)ccn3)c3cccc4ccccc34)ccc2)n1.[Pt] |
| InChI | InChI=1S/C44H30N3O.Pt/c48-43-24-10-9-22-39(43)41-29-36(32-15-5-2-6-16-32)28-40(46-41)35-19-11-20-37(27-35)47(42-23-12-18-33-17-7-8-21-38(33)42)44-30-34(25-26-45-44)31-13-3-1-4-14-31;/h1-26,28-30,48H;/q-1; |
| InChIKey | PGKGFOJGOLKWHB-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.82 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|