C56H52N3OPt- — CID 164743326
2,4-ditert-butyl-6-[4-phenyl-6-[3-(N-[4-[4-(1-phenylethyl)phenyl]-2-pyridinyl]anilino)benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 164743326) has the molecular formula C56H52N3OPt- and a molecular weight of 978.13 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-phenyl-6-[3-(N-[4-[4-(1-phenylethyl)phenyl]-2-pyridinyl]anilino)benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[4-phenyl-6-[3-(N-[4-[4-(1-phenylethyl)phenyl]-2-pyridinyl]anilino)benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 164743326 |
| Molecular Formula | C56H52N3OPt- |
| Molecular Weight | 978.13 g/mol |
| Exact Mass | 977.38 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-phenyl-6-[3-(N-[4-[4-(1-phenylethyl)phenyl]-2-pyridinyl]anilino)benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | CC(c1ccccc1)c1ccc(-c2ccnc(N(c3[c-]c(-c4cc(-c5ccccc5)cc(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5O)n4)ccc3)c3ccccc3)c2)cc1.[Pt] |
| InChI | InChI=1S/C56H52N3O.Pt/c1-38(39-18-11-8-12-19-39)40-26-28-42(29-27-40)43-30-31-57-53(35-43)59(47-23-15-10-16-24-47)48-25-17-22-44(32-48)51-33-45(41-20-13-9-14-21-41)34-52(58-51)49-36-46(55(2,3)4)37-50(54(49)60)56(5,6)7;/h8-31,33-38,60H,1-7H3;/q-1; |
| InChIKey | JCYRGMYSLFANEU-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.13 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|