C50H50N5OPt- — CID 153280503
2,4-ditert-butyl-6-[4-tert-butyl-6-[3-(2,6-diphenyl-N-pyridin-2-ylanilino)benzene-2-id-1-yl]-1,3,5-triazin-2-yl]phenol;platinum (PubChem CID 153280503) has the molecular formula C50H50N5OPt- and a molecular weight of 932.06 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-tert-butyl-6-[3-(2,6-diphenyl-N-pyridin-2-ylanilino)benzene-2-id-1-yl]-1,3,5-triazin-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[4-tert-butyl-6-[3-(2,6-diphenyl-N-pyridin-2-ylanilino)benzene-2-id-1-yl]-1,3,5-triazin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280503 |
| Molecular Formula | C50H50N5OPt- |
| Molecular Weight | 932.06 g/mol |
| Exact Mass | 931.37 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-tert-butyl-6-[3-(2,6-diphenyl-N-pyridin-2-ylanilino)benzene-2-id-1-yl]-1,3,5-triazin-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2nc(-c3[c-]c(N(c4ccccn4)c4c(-c5ccccc5)cccc4-c4ccccc4)ccc3)nc(C(C)(C)C)n2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C50H50N5O.Pt/c1-48(2,3)36-31-40(44(56)41(32-36)49(4,5)6)46-52-45(53-47(54-46)50(7,8)9)35-24-18-25-37(30-35)55(42-28-16-17-29-51-42)43-38(33-20-12-10-13-21-33)26-19-27-39(43)34-22-14-11-15-23-34;/h10-29,31-32,56H,1-9H3;/q-1; |
| InChIKey | AUDGFPMELWPUPP-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 75.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.06 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|