C36H35N2O2Pt- — CID 153304201
2,4-ditert-butyl-6-[5-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-2-pyridinyl]phenol;platinum (PubChem CID 153304201) has the molecular formula C36H35N2O2Pt- and a molecular weight of 722.77 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[5-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-2-pyridinyl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[5-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 153304201 |
| Molecular Formula | C36H35N2O2Pt- |
| Molecular Weight | 722.77 g/mol |
| Exact Mass | 722.24 |
| IUPAC Name | 2,4-ditert-butyl-6-[5-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2ccc(-c3ccccc3)c(-c3[c-]c(Oc4ccccn4)ccc3)n2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C36H35N2O2.Pt/c1-35(2,3)26-22-29(34(39)30(23-26)36(4,5)6)31-19-18-28(24-13-8-7-9-14-24)33(38-31)25-15-12-16-27(21-25)40-32-17-10-11-20-37-32;/h7-20,22-23,39H,1-6H3;/q-1; |
| InChIKey | HVHPDKCNIIFYEP-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.77 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|