C31H25N2O2Pt- — CID 153304161
platinum;2-[6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4-(2,4,6-trimethylphenyl)-2-pyridinyl]phenol (PubChem CID 153304161) has the molecular formula C31H25N2O2Pt- and a molecular weight of 652.63 g/mol. Its IUPAC name is platinum;2-[6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4-(2,4,6-trimethylphenyl)-2-pyridinyl]phenol.
| Compound Name | platinum;2-[6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4-(2,4,6-trimethylphenyl)-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 153304161 |
| Molecular Formula | C31H25N2O2Pt- |
| Molecular Weight | 652.63 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | platinum;2-[6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4-(2,4,6-trimethylphenyl)-2-pyridinyl]phenol |
| SMILES | Cc1cc(C)c(-c2cc(-c3[c-]c(Oc4ccccn4)ccc3)nc(-c3ccccc3O)c2)c(C)c1.[Pt] |
| InChI | InChI=1S/C31H25N2O2.Pt/c1-20-15-21(2)31(22(3)16-20)24-18-27(33-28(19-24)26-11-4-5-12-29(26)34)23-9-8-10-25(17-23)35-30-13-6-7-14-32-30;/h4-16,18-19,34H,1-3H3;/q-1; |
| InChIKey | URPHLPGFRUYIQS-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.63 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|