About platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol
platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol (PubChem CID 153280343) has the molecular formula C21H14N3O2Pt-
and a molecular weight of 535.44 g/mol. Its IUPAC name is platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol.
Molecular Properties
| Compound Name | platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol |
| PubChem CID | 153280343 |
| Molecular Formula | C21H14N3O2Pt- |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol |
| SMILES | Oc1ccccc1-c1[c-]c(-c2cccc(Oc3ccccn3)n2)ccn1.[Pt] |
| InChI | InChI=1S/C21H14N3O2.Pt/c25-19-8-2-1-6-16(19)18-14-15(11-13-22-18)17-7-5-10-21(24-17)26-20-9-3-4-12-23-20;/h1-13,25H;/q-1; |
| InChIKey | ANUUZFYIJPVQOH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol?
The IUPAC name of platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol (CID 153280343) is platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol.
What is the SMILES notation for platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol?
The canonical SMILES for platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol is Oc1ccccc1-c1[c-]c(-c2cccc(Oc3ccccn3)n2)ccn1.[Pt].
What is the InChIKey of platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol?
The InChIKey is ANUUZFYIJPVQOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N3O2.Pt/c25-19-8-2-1-6-16(19)18-14-15(11-13-22-18)17-7-5-10-21(24-17)26-20-9-3-4-12-23-20;/h1-13,25H;/q-1;.
What are the key properties of platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol?
platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol has a molecular weight of 535.44 g/mol, XLogP of 4.50, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;2-[4-(6-pyridin-2-yloxy-2-pyridinyl)-3H-pyridin-3-id-2-yl]phenol is sourced from PubChem (CID 153280343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).