C24H20N4OPtS — CID 153280451
2-[2-tert-butyl-6-(6-pyridin-2-yloxy-2-pyridinyl)-5H-pyrimidin-5-id-4-yl]benzenethiolate;platinum(2+) (PubChem CID 153280451) has the molecular formula C24H20N4OPtS and a molecular weight of 607.60 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-(6-pyridin-2-yloxy-2-pyridinyl)-5H-pyrimidin-5-id-4-yl]benzenethiolate;platinum(2+).
| Compound Name | 2-[2-tert-butyl-6-(6-pyridin-2-yloxy-2-pyridinyl)-5H-pyrimidin-5-id-4-yl]benzenethiolate;platinum(2+) |
|---|---|
| PubChem CID | 153280451 |
| Molecular Formula | C24H20N4OPtS |
| Molecular Weight | 607.60 g/mol |
| Exact Mass | 607.10 |
| IUPAC Name | 2-[2-tert-butyl-6-(6-pyridin-2-yloxy-2-pyridinyl)-5H-pyrimidin-5-id-4-yl]benzenethiolate;platinum(2+) |
| SMILES | CC(C)(C)c1nc(-c2cccc(Oc3ccccn3)n2)[c-]c(-c2ccccc2[S-])n1.[Pt+2] |
| InChI | InChI=1S/C24H21N4OS.Pt/c1-24(2,3)23-27-18(16-9-4-5-11-20(16)30)15-19(28-23)17-10-8-13-22(26-17)29-21-12-6-7-14-25-21;/h4-14,30H,1-3H3;/q-1;+2/p-1 |
| InChIKey | ZZQYYURFLDZRHG-UHFFFAOYSA-M |
| XLogP | 5.39 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|