About lithium;2-tert-butylpyrimidine;bromide
lithium;2-tert-butylpyrimidine;bromide (PubChem CID 160712355) has the molecular formula C8H12BrLiN2
and a molecular weight of 223.04 g/mol. Its IUPAC name is lithium;2-tert-butylpyrimidine;bromide.
Molecular Properties
| Compound Name | lithium;2-tert-butylpyrimidine;bromide |
| PubChem CID | 160712355 |
| Molecular Formula | C8H12BrLiN2 |
| Molecular Weight | 223.04 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | lithium;2-tert-butylpyrimidine;bromide |
| SMILES | CC(C)(C)c1ncccn1.[Br-].[Li+] |
| InChI | InChI=1S/C8H12N2.BrH.Li/c1-8(2,3)7-9-5-4-6-10-7;;/h4-6H,1-3H3;1H;/q;;+1/p-1 |
| InChIKey | RSAIZMIUSLFDJC-UHFFFAOYSA-M |
| XLogP | -4.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.04 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium;2-tert-butylpyrimidine;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;2-tert-butylpyrimidine;bromide?
The IUPAC name of lithium;2-tert-butylpyrimidine;bromide (CID 160712355) is lithium;2-tert-butylpyrimidine;bromide.
What is the SMILES notation for lithium;2-tert-butylpyrimidine;bromide?
The canonical SMILES for lithium;2-tert-butylpyrimidine;bromide is CC(C)(C)c1ncccn1.[Br-].[Li+].
What is the InChIKey of lithium;2-tert-butylpyrimidine;bromide?
The InChIKey is RSAIZMIUSLFDJC-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H12N2.BrH.Li/c1-8(2,3)7-9-5-4-6-10-7;;/h4-6H,1-3H3;1H;/q;;+1/p-1.
What are the key properties of lithium;2-tert-butylpyrimidine;bromide?
lithium;2-tert-butylpyrimidine;bromide has a molecular weight of 223.04 g/mol, XLogP of -4.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;2-tert-butylpyrimidine;bromide is sourced from PubChem (CID 160712355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).