About 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole
2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole (PubChem CID 165041459) has the molecular formula C22H34FN7
and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole.
Molecular Properties
| Compound Name | 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole |
| PubChem CID | 165041459 |
| Molecular Formula | C22H34FN7 |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole |
| SMILES | CC(C)(C)c1ncc(F)cn1.CC(C)(C)c1ncccn1.CC(C)(C)n1nccn1 |
| InChI | InChI=1S/C8H11FN2.C8H12N2.C6H11N3/c1-8(2,3)7-10-4-6(9)5-11-7;1-8(2,3)7-9-5-4-6-10-7;1-6(2,3)9-7-4-5-8-9/h4-5H,1-3H3;4-6H,1-3H3;4-5H,1-3H3 |
| InChIKey | OEQTVSBHRLVEDQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole?
The IUPAC name of 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole (CID 165041459) is 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole.
What is the SMILES notation for 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole?
The canonical SMILES for 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole is CC(C)(C)c1ncc(F)cn1.CC(C)(C)c1ncccn1.CC(C)(C)n1nccn1.
What is the InChIKey of 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole?
The InChIKey is OEQTVSBHRLVEDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2.C8H12N2.C6H11N3/c1-8(2,3)7-10-4-6(9)5-11-7;1-8(2,3)7-9-5-4-6-10-7;1-6(2,3)9-7-4-5-8-9/h4-5H,1-3H3;4-6H,1-3H3;4-5H,1-3H3.
What are the key properties of 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole?
2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole has a molecular weight of 415.56 g/mol, XLogP of 4.72, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-fluoropyrimidine;2-tert-butylpyrimidine;2-tert-butyltriazole is sourced from PubChem (CID 165041459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).