C11H10ClFN4O2S — CID 150854643
2-(2-chloro-1-pyrimidin-2-ylsulfonylpropan-2-yl)-5-fluoropyrimidine (PubChem CID 150854643) has the molecular formula C11H10ClFN4O2S and a molecular weight of 316.75 g/mol. Its IUPAC name is 2-(2-chloro-1-pyrimidin-2-ylsulfonylpropan-2-yl)-5-fluoropyrimidine.
| Compound Name | 2-(2-chloro-1-pyrimidin-2-ylsulfonylpropan-2-yl)-5-fluoropyrimidine |
|---|---|
| PubChem CID | 150854643 |
| Molecular Formula | C11H10ClFN4O2S |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-(2-chloro-1-pyrimidin-2-ylsulfonylpropan-2-yl)-5-fluoropyrimidine |
| SMILES | CC(Cl)(CS(=O)(=O)c1ncccn1)c1ncc(F)cn1 |
| InChI | InChI=1S/C11H10ClFN4O2S/c1-11(12,9-16-5-8(13)6-17-9)7-20(18,19)10-14-3-2-4-15-10/h2-6H,7H2,1H3 |
| InChIKey | KQTFVJAACWQMPK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|