C17H10N2O3PtS — CID 58709124
platinum(2+);6-(3-pyridin-2-yloxybenzene-2-id-1-yl)oxypyridine-2-carbothioate (PubChem CID 58709124) has the molecular formula C17H10N2O3PtS and a molecular weight of 517.42 g/mol. Its IUPAC name is platinum(2+);6-(3-pyridin-2-yloxybenzene-2-id-1-yl)oxypyridine-2-carbothioate.
| Compound Name | platinum(2+);6-(3-pyridin-2-yloxybenzene-2-id-1-yl)oxypyridine-2-carbothioate |
|---|---|
| PubChem CID | 58709124 |
| Molecular Formula | C17H10N2O3PtS |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | platinum(2+);6-(3-pyridin-2-yloxybenzene-2-id-1-yl)oxypyridine-2-carbothioate |
| SMILES | O=C([S-])c1cccc(Oc2[c-]c(Oc3ccccn3)ccc2)n1.[Pt+2] |
| InChI | InChI=1S/C17H11N2O3S.Pt/c20-17(23)14-7-4-9-16(19-14)22-13-6-3-5-12(11-13)21-15-8-1-2-10-18-15;/h1-10H,(H,20,23);/q-1;+2/p-1 |
| InChIKey | XAMUBZLSZHMGDR-UHFFFAOYSA-M |
| XLogP | 3.55 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|