C28H17N2O2PPt — CID 153421804
5-(5-deuterio-2-pyridinyl)-3-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4H-benzo[b]phosphindol-4-ide 5-oxide;platinum(2+) (PubChem CID 153421804) has the molecular formula C28H17N2O2PPt and a molecular weight of 640.51 g/mol. Its IUPAC name is 5-(5-deuterio-2-pyridinyl)-3-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4H-benzo[b]phosphindol-4-ide 5-oxide;platinum(2+).
| Compound Name | 5-(5-deuterio-2-pyridinyl)-3-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4H-benzo[b]phosphindol-4-ide 5-oxide;platinum(2+) |
|---|---|
| PubChem CID | 153421804 |
| Molecular Formula | C28H17N2O2PPt |
| Molecular Weight | 640.51 g/mol |
| Exact Mass | 640.07 |
| IUPAC Name | 5-(5-deuterio-2-pyridinyl)-3-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4H-benzo[b]phosphindol-4-ide 5-oxide;platinum(2+) |
| SMILES | [2H]c1ccc(P2(=O)c3[c-]c(-c4[c-]c(Oc5ccccn5)ccc4)ccc3-c3ccccc32)nc1.[Pt+2] |
| InChI | InChI=1S/C28H17N2O2P.Pt/c31-33(28-13-4-6-17-30-28)25-11-2-1-10-23(25)24-15-14-21(19-26(24)33)20-8-7-9-22(18-20)32-27-12-3-5-16-29-27;/h1-17H;/q-2;+2/i6D; |
| InChIKey | OKWFBKOAFCSHGN-FNZLVDGMSA-N |
| XLogP | 5.15 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|