C28H17BiN2OPt — CID 153421520
3-deuterio-2-[3-(5-pyridin-2-yl-4H-benzo[b][1]benzobismol-4-id-3-yl)benzene-2-id-1-yl]oxypyridine;platinum(2+) (PubChem CID 153421520) has the molecular formula C28H17BiN2OPt and a molecular weight of 802.52 g/mol. Its IUPAC name is 3-deuterio-2-[3-(5-pyridin-2-yl-4H-benzo[b][1]benzobismol-4-id-3-yl)benzene-2-id-1-yl]oxypyridine;platinum(2+).
| Compound Name | 3-deuterio-2-[3-(5-pyridin-2-yl-4H-benzo[b][1]benzobismol-4-id-3-yl)benzene-2-id-1-yl]oxypyridine;platinum(2+) |
|---|---|
| PubChem CID | 153421520 |
| Molecular Formula | C28H17BiN2OPt |
| Molecular Weight | 802.52 g/mol |
| Exact Mass | 802.09 |
| IUPAC Name | 3-deuterio-2-[3-(5-pyridin-2-yl-4H-benzo[b][1]benzobismol-4-id-3-yl)benzene-2-id-1-yl]oxypyridine;platinum(2+) |
| SMILES | [2H]c1cccnc1Oc1[c-]c(-c2[c-]c3c(cc2)-c2ccccc2[Bi]3c2ccccn2)ccc1.[Pt+2] |
| InChI | InChI=1S/C23H13NO.C5H4N.Bi.Pt/c1-2-7-18(8-3-1)19-12-14-20(15-13-19)21-9-6-10-22(17-21)25-23-11-4-5-16-24-23;1-2-4-6-5-3-1;;/h1-7,9-12,14,16H;1-4H;;/q-2;;;+2/i11D;;; |
| InChIKey | FKEXOIYUVKJZQO-IRSALVBCSA-N |
| XLogP | 4.03 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|