C29H19BN2OPt — CID 153421060
4-methyl-2-[3-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4H-benzo[b][1]benzoborol-4-id-5-yl]pyridine;platinum(2+) (PubChem CID 153421060) has the molecular formula C29H19BN2OPt and a molecular weight of 617.37 g/mol. Its IUPAC name is 4-methyl-2-[3-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4H-benzo[b][1]benzoborol-4-id-5-yl]pyridine;platinum(2+).
| Compound Name | 4-methyl-2-[3-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4H-benzo[b][1]benzoborol-4-id-5-yl]pyridine;platinum(2+) |
|---|---|
| PubChem CID | 153421060 |
| Molecular Formula | C29H19BN2OPt |
| Molecular Weight | 617.37 g/mol |
| Exact Mass | 617.12 |
| IUPAC Name | 4-methyl-2-[3-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4H-benzo[b][1]benzoborol-4-id-5-yl]pyridine;platinum(2+) |
| SMILES | Cc1ccnc(B2c3[c-]c(-c4[c-]c(Oc5ccccn5)ccc4)ccc3-c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C29H19BN2O.Pt/c1-20-14-16-31-28(17-20)30-26-10-3-2-9-24(26)25-13-12-22(19-27(25)30)21-7-6-8-23(18-21)33-29-11-4-5-15-32-29;/h2-17H,1H3;/q-2;+2 |
| InChIKey | NOGGUYILFBPETG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|