C28H17BN2OPt — CID 153421464
4-deuterio-2-[3-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4H-benzo[b][1]benzoborol-4-id-5-yl]pyridine;platinum(2+) (PubChem CID 153421464) has the molecular formula C28H17BN2OPt and a molecular weight of 604.35 g/mol. Its IUPAC name is 4-deuterio-2-[3-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4H-benzo[b][1]benzoborol-4-id-5-yl]pyridine;platinum(2+).
| Compound Name | 4-deuterio-2-[3-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4H-benzo[b][1]benzoborol-4-id-5-yl]pyridine;platinum(2+) |
|---|---|
| PubChem CID | 153421464 |
| Molecular Formula | C28H17BN2OPt |
| Molecular Weight | 604.35 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | 4-deuterio-2-[3-(3-pyridin-2-yloxybenzene-2-id-1-yl)-4H-benzo[b][1]benzoborol-4-id-5-yl]pyridine;platinum(2+) |
| SMILES | [2H]c1ccnc(B2c3[c-]c(-c4[c-]c(Oc5ccccn5)ccc4)ccc3-c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C28H17BN2O.Pt/c1-2-11-25-23(10-1)24-15-14-21(19-26(24)29(25)27-12-3-5-16-30-27)20-8-7-9-22(18-20)32-28-13-4-6-17-31-28;/h1-17H;/q-2;+2/i3D; |
| InChIKey | ZVWUDSPLSZXILM-RFQDWOGUSA-N |
| XLogP | 4.03 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|