C28H15F2N3OPt — CID 153421046
9-(5,6-difluoro-2-pyridinyl)-2-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153421046) has the molecular formula C28H15F2N3OPt and a molecular weight of 642.52 g/mol. Its IUPAC name is 9-(5,6-difluoro-2-pyridinyl)-2-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-(5,6-difluoro-2-pyridinyl)-2-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153421046 |
| Molecular Formula | C28H15F2N3OPt |
| Molecular Weight | 642.52 g/mol |
| Exact Mass | 642.08 |
| IUPAC Name | 9-(5,6-difluoro-2-pyridinyl)-2-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1H-carbazol-1-ide;platinum(2+) |
| SMILES | Fc1ccc(-n2c3[c-]c(-c4[c-]c(Oc5ccccn5)ccc4)ccc3c3ccccc32)nc1F.[Pt+2] |
| InChI | InChI=1S/C28H15F2N3O.Pt/c29-23-13-14-26(32-28(23)30)33-24-9-2-1-8-21(24)22-12-11-19(17-25(22)33)18-6-5-7-20(16-18)34-27-10-3-4-15-31-27;/h1-15H;/q-2;+2 |
| InChIKey | ZGTLWBWXTOXQPN-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.52 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|