C36H33N3OPt — CID 153421636
9-(3,4-ditert-butyl-2-pyridinyl)-2-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153421636) has the molecular formula C36H33N3OPt and a molecular weight of 718.76 g/mol. Its IUPAC name is 9-(3,4-ditert-butyl-2-pyridinyl)-2-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-(3,4-ditert-butyl-2-pyridinyl)-2-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153421636 |
| Molecular Formula | C36H33N3OPt |
| Molecular Weight | 718.76 g/mol |
| Exact Mass | 718.23 |
| IUPAC Name | 9-(3,4-ditert-butyl-2-pyridinyl)-2-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(-c4[c-]c(Oc5ccccn5)ccc4)ccc3c3ccccc32)c1C(C)(C)C.[Pt+2] |
| InChI | InChI=1S/C36H33N3O.Pt/c1-35(2,3)29-19-21-38-34(33(29)36(4,5)6)39-30-15-8-7-14-27(30)28-18-17-25(23-31(28)39)24-12-11-13-26(22-24)40-32-16-9-10-20-37-32;/h7-21H,1-6H3;/q-2;+2 |
| InChIKey | BCRPJNOOZZJRRV-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.76 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|