C32H25N3OPt — CID 153421036
2-[3-[(4,5-diethyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153421036) has the molecular formula C32H25N3OPt and a molecular weight of 662.65 g/mol. Its IUPAC name is 2-[3-[(4,5-diethyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[3-[(4,5-diethyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153421036 |
| Molecular Formula | C32H25N3OPt |
| Molecular Weight | 662.65 g/mol |
| Exact Mass | 662.16 |
| IUPAC Name | 2-[3-[(4,5-diethyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CCc1cnc(Oc2[c-]c(-c3[c-]c4c(cc3)c3ccccc3n4-c3ccccn3)ccc2)cc1CC.[Pt+2] |
| InChI | InChI=1S/C32H25N3O.Pt/c1-3-22-20-32(34-21-23(22)4-2)36-26-11-9-10-24(18-26)25-15-16-28-27-12-5-6-13-29(27)35(30(28)19-25)31-14-7-8-17-33-31;/h5-17,20-21H,3-4H2,1-2H3;/q-2;+2 |
| InChIKey | XZVZOLCMCGGZTH-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.65 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|