C32H20B2N3OPt-3 — CID 153494996
2-[[5-phenyl-10-(3-pyrazol-2-id-3-ylbenzene-2-id-1-yl)-1H-boranthren-1-id-2-yl]oxy]pyridine;platinum (PubChem CID 153494996) has the molecular formula C32H20B2N3OPt-3 and a molecular weight of 679.23 g/mol. Its IUPAC name is 2-[[5-phenyl-10-(3-pyrazol-2-id-3-ylbenzene-2-id-1-yl)-1H-boranthren-1-id-2-yl]oxy]pyridine;platinum.
| Compound Name | 2-[[5-phenyl-10-(3-pyrazol-2-id-3-ylbenzene-2-id-1-yl)-1H-boranthren-1-id-2-yl]oxy]pyridine;platinum |
|---|---|
| PubChem CID | 153494996 |
| Molecular Formula | C32H20B2N3OPt-3 |
| Molecular Weight | 679.23 g/mol |
| Exact Mass | 679.15 |
| IUPAC Name | 2-[[5-phenyl-10-(3-pyrazol-2-id-3-ylbenzene-2-id-1-yl)-1H-boranthren-1-id-2-yl]oxy]pyridine;platinum |
| SMILES | [Pt].[c-]1c(B2c3[c-]c(Oc4ccccn4)ccc3B(c3ccccc3)c3ccccc32)cccc1-c1ccn[n-]1 |
| InChI | InChI=1S/C32H20B2N3O.Pt/c1-2-10-24(11-3-1)33-27-13-4-5-14-28(27)34(25-12-8-9-23(21-25)31-18-20-36-37-31)30-22-26(16-17-29(30)33)38-32-15-6-7-19-35-32;/h1-20H;/q-3; |
| InChIKey | FMHKHFLUFFSQGL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|