C27H24IrN2O4-2 — CID 146899920
iridium;pent-2-ene-2,4-diol;2-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]oxypyridine (PubChem CID 146899920) has the molecular formula C27H24IrN2O4-2 and a molecular weight of 632.72 g/mol. Its IUPAC name is iridium;pent-2-ene-2,4-diol;2-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]oxypyridine.
| Compound Name | iridium;pent-2-ene-2,4-diol;2-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]oxypyridine |
|---|---|
| PubChem CID | 146899920 |
| Molecular Formula | C27H24IrN2O4-2 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 633.14 |
| IUPAC Name | iridium;pent-2-ene-2,4-diol;2-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]oxypyridine |
| SMILES | CC(O)=CC(C)O.[Ir].[c-]1c(Oc2[c-]c(-c3ccccn3)ccc2)cccc1Oc1ccccn1 |
| InChI | InChI=1S/C22H14N2O2.C5H10O2.Ir/c1-3-13-23-21(11-1)17-7-5-8-18(15-17)25-19-9-6-10-20(16-19)26-22-12-2-4-14-24-22;1-4(6)3-5(2)7;/h1-14H;3-4,6-7H,1-2H3;/q-2;; |
| InChIKey | CLOFDEZJMCKGAO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|