C26H22N2OPd — CID 162451616
2-[3-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)oxybenzene-2-id-1-yl]pyridine;palladium(2+) (PubChem CID 162451616) has the molecular formula C26H22N2OPd and a molecular weight of 484.90 g/mol. Its IUPAC name is 2-[3-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)oxybenzene-2-id-1-yl]pyridine;palladium(2+).
| Compound Name | 2-[3-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)oxybenzene-2-id-1-yl]pyridine;palladium(2+) |
|---|---|
| PubChem CID | 162451616 |
| Molecular Formula | C26H22N2OPd |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 2-[3-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)oxybenzene-2-id-1-yl]pyridine;palladium(2+) |
| SMILES | CC(C)(C)c1cc(Oc2[c-]c(-c3ccccn3)ccc2)[c-]c(-c2ccccn2)c1.[Pd+2] |
| InChI | InChI=1S/C26H22N2O.Pd/c1-26(2,3)21-15-20(25-12-5-7-14-28-25)17-23(18-21)29-22-10-8-9-19(16-22)24-11-4-6-13-27-24;/h4-15,18H,1-3H3;/q-2;+2 |
| InChIKey | XAMOOZGGHHNKOL-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|