C46H37N3OPt — CID 165161257
CID 165161257 (PubChem CID 165161257) has the molecular formula C46H37N3OPt and a molecular weight of 842.90 g/mol.
| Compound Name | CID 165161257 |
|---|---|
| PubChem CID | 165161257 |
| Molecular Formula | C46H37N3OPt |
| Molecular Weight | 842.90 g/mol |
| Exact Mass | 842.26 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]c(Oc3[c-]c(-c4ccccn4)c4cc5c(cc4c3)c3cccc4c6cc(C(C)(C)C)ccc6n5c43)ccc2)c1.[Pt+2] |
| InChI | InChI=1S/C46H37N3O.Pt/c1-45(2,3)30-16-17-42-39(24-30)35-14-10-13-34-38-23-29-22-33(26-37(40-15-7-8-19-47-40)36(29)27-43(38)49(42)44(34)35)50-32-12-9-11-28(21-32)41-25-31(18-20-48-41)46(4,5)6;/h7-20,22-25,27H,1-6H3;/q-2;+2 |
| InChIKey | DBTIWWHKPNDHFZ-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.90 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|