C42H30N4OPd — CID 162487202
CID 162487202 (PubChem CID 162487202) has the molecular formula C42H30N4OPd and a molecular weight of 713.15 g/mol.
| Compound Name | CID 162487202 |
|---|---|
| PubChem CID | 162487202 |
| Molecular Formula | C42H30N4OPd |
| Molecular Weight | 713.15 g/mol |
| Exact Mass | 712.15 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]c(Oc3[c-]c4c(cc3)c3ccc5c(c6ccccc6n5-c5ccccc5)c3n3ccnc43)ccc2)c1.[Pd+2] |
| InChI | InChI=1S/C42H30N4O.Pd/c1-42(2,3)28-20-21-43-36(25-28)27-10-9-13-30(24-27)47-31-16-17-32-33-18-19-38-39(40(33)45-23-22-44-41(45)35(32)26-31)34-14-7-8-15-37(34)46(38)29-11-5-4-6-12-29;/h4-23,25H,1-3H3;/q-2;+2 |
| InChIKey | ZGGOXVFVBIKPQD-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.15 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|