C38H35N3OPt — CID 156667220
4-[3-[3-(4-tert-butyl-2-pyridinyl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-8-(2,2-dimethylpropyl)-3,7-phenanthroline;platinum(2+) (PubChem CID 156667220) has the molecular formula C38H35N3OPt and a molecular weight of 744.80 g/mol. Its IUPAC name is 4-[3-[3-(4-tert-butyl-2-pyridinyl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-8-(2,2-dimethylpropyl)-3,7-phenanthroline;platinum(2+).
| Compound Name | 4-[3-[3-(4-tert-butyl-2-pyridinyl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-8-(2,2-dimethylpropyl)-3,7-phenanthroline;platinum(2+) |
|---|---|
| PubChem CID | 156667220 |
| Molecular Formula | C38H35N3OPt |
| Molecular Weight | 744.80 g/mol |
| Exact Mass | 744.24 |
| IUPAC Name | 4-[3-[3-(4-tert-butyl-2-pyridinyl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-8-(2,2-dimethylpropyl)-3,7-phenanthroline;platinum(2+) |
| SMILES | CC(C)(C)Cc1ccc2c(ccc3c(-c4[c-]c(Oc5[c-]c(-c6cc(C(C)(C)C)ccn6)ccc5)ccc4)nccc32)n1.[Pt+2] |
| InChI | InChI=1S/C38H35N3O.Pt/c1-37(2,3)24-28-13-14-32-31-18-20-40-36(33(31)15-16-34(32)41-28)26-10-8-12-30(22-26)42-29-11-7-9-25(21-29)35-23-27(17-19-39-35)38(4,5)6;/h7-20,23H,24H2,1-6H3;/q-2;+2 |
| InChIKey | IJAXTCCSARVNDW-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.80 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|