C46H40N4OPt — CID 156667162
4-(2,2-dimethylpropyl)-7-[3-[3-[4-(2,2-dimethylpropyl)-1,8-phenanthrolin-7-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-1,8-phenanthroline;platinum(2+) (PubChem CID 156667162) has the molecular formula C46H40N4OPt and a molecular weight of 859.93 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-7-[3-[3-[4-(2,2-dimethylpropyl)-1,8-phenanthrolin-7-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-1,8-phenanthroline;platinum(2+).
| Compound Name | 4-(2,2-dimethylpropyl)-7-[3-[3-[4-(2,2-dimethylpropyl)-1,8-phenanthrolin-7-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-1,8-phenanthroline;platinum(2+) |
|---|---|
| PubChem CID | 156667162 |
| Molecular Formula | C46H40N4OPt |
| Molecular Weight | 859.93 g/mol |
| Exact Mass | 859.29 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-7-[3-[3-[4-(2,2-dimethylpropyl)-1,8-phenanthrolin-7-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-1,8-phenanthroline;platinum(2+) |
| SMILES | CC(C)(C)Cc1ccnc2c1ccc1c(-c3[c-]c(Oc4[c-]c(-c5nccc6c5ccc5c(CC(C)(C)C)ccnc56)ccc4)ccc3)nccc12.[Pt+2] |
| InChI | InChI=1S/C46H40N4O.Pt/c1-45(2,3)27-31-17-21-49-43-35(31)13-15-37-39(43)19-23-47-41(37)29-9-7-11-33(25-29)51-34-12-8-10-30(26-34)42-38-16-14-36-32(28-46(4,5)6)18-22-50-44(36)40(38)20-24-48-42;/h7-24H,27-28H2,1-6H3;/q-2;+2 |
| InChIKey | VLZDTHDBGYPTMN-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.93 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|