C52H30N2OPtS — CID 164939637
platinum(2+);1-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]-7-tetraphenylen-2-yl-[1]benzothiolo[2,3-c]pyridine (PubChem CID 164939637) has the molecular formula C52H30N2OPtS and a molecular weight of 925.97 g/mol. Its IUPAC name is platinum(2+);1-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]-7-tetraphenylen-2-yl-[1]benzothiolo[2,3-c]pyridine.
| Compound Name | platinum(2+);1-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]-7-tetraphenylen-2-yl-[1]benzothiolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 164939637 |
| Molecular Formula | C52H30N2OPtS |
| Molecular Weight | 925.97 g/mol |
| Exact Mass | 925.17 |
| IUPAC Name | platinum(2+);1-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]-7-tetraphenylen-2-yl-[1]benzothiolo[2,3-c]pyridine |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c(-c3nccc4c3sc3cc(-c5ccc6c(c5)-c5ccccc5-c5ccccc5-c5ccccc5-6)ccc34)ccc2)cccc1-c1ccccn1 |
| InChI | InChI=1S/C52H30N2OS.Pt/c1-2-16-40-39(15-1)41-17-3-4-19-43(41)45-24-22-33(31-48(45)44-20-6-5-18-42(40)44)34-23-25-46-47-26-28-54-51(52(47)56-50(46)32-34)36-12-10-14-38(30-36)55-37-13-9-11-35(29-37)49-21-7-8-27-53-49;/h1-28,31-32H;/q-2;+2/b41-39-,42-40-,45-43-,48-44-; |
| InChIKey | RELGLPSJTGEKQO-QNKBAKOISA-N |
| XLogP | 14.22 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.97 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|