C32H18N2OPtS — CID 164939815
15-[3-[(6-phenyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene;platinum(2+) (PubChem CID 164939815) has the molecular formula C32H18N2OPtS and a molecular weight of 673.65 g/mol. Its IUPAC name is 15-[3-[(6-phenyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene;platinum(2+).
| Compound Name | 15-[3-[(6-phenyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene;platinum(2+) |
|---|---|
| PubChem CID | 164939815 |
| Molecular Formula | C32H18N2OPtS |
| Molecular Weight | 673.65 g/mol |
| Exact Mass | 673.08 |
| IUPAC Name | 15-[3-[(6-phenyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene;platinum(2+) |
| SMILES | [Pt+2].[c-]1ccccc1-c1cccc(Oc2[c-]c(-c3nccc4c3sc3c5ccccc5ccc43)ccc2)n1 |
| InChI | InChI=1S/C32H18N2OS.Pt/c1-2-9-22(10-3-1)28-14-7-15-29(34-28)35-24-12-6-11-23(20-24)30-32-27(18-19-33-30)26-17-16-21-8-4-5-13-25(21)31(26)36-32;/h1-9,11-19H;/q-2;+2 |
| InChIKey | HDOZHAHBEYBURG-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.65 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|