C26H17N3Pt — CID 155601727
(1Z,3Z)-1-[(6-phenyl-2-pyridinyl)methylidene]-3-(pyridin-2-ylmethylidene)isoindol-2-ide;platinum(2+) (PubChem CID 155601727) has the molecular formula C26H17N3Pt and a molecular weight of 566.52 g/mol. Its IUPAC name is (1Z,3Z)-1-[(6-phenyl-2-pyridinyl)methylidene]-3-(pyridin-2-ylmethylidene)isoindol-2-ide;platinum(2+).
| Compound Name | (1Z,3Z)-1-[(6-phenyl-2-pyridinyl)methylidene]-3-(pyridin-2-ylmethylidene)isoindol-2-ide;platinum(2+) |
|---|---|
| PubChem CID | 155601727 |
| Molecular Formula | C26H17N3Pt |
| Molecular Weight | 566.52 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | (1Z,3Z)-1-[(6-phenyl-2-pyridinyl)methylidene]-3-(pyridin-2-ylmethylidene)isoindol-2-ide;platinum(2+) |
| SMILES | [Pt+2].[c-]1ccccc1-c1cccc(/C=c2\[n-]/c(=C\c3ccccn3)c3ccccc23)n1 |
| InChI | InChI=1S/C26H17N3.Pt/c1-2-9-19(10-3-1)24-15-8-12-21(28-24)18-26-23-14-5-4-13-22(23)25(29-26)17-20-11-6-7-16-27-20;/h1-9,11-18H;/q-2;+2/b25-17-,26-18-; |
| InChIKey | BMGGGFNCFGUCSH-QYKVWKNESA-N |
| XLogP | 3.71 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|