About 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+)
2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+) (PubChem CID 58871037) has the molecular formula C22H14N2PtS
and a molecular weight of 533.51 g/mol. Its IUPAC name is 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+).
Molecular Properties
| Compound Name | 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+) |
| PubChem CID | 58871037 |
| Molecular Formula | C22H14N2PtS |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+) |
| SMILES | [Pt+2].[c-]1ccccc1-c1[c-]c(-c2cccc(Sc3ccccn3)n2)ccc1 |
| InChI | InChI=1S/C22H14N2S.Pt/c1-2-8-17(9-3-1)18-10-6-11-19(16-18)20-12-7-14-22(24-20)25-21-13-4-5-15-23-21;/h1-8,10-15H;/q-2;+2 |
| InChIKey | JNTRSSAWINYKID-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+)?
The IUPAC name of 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+) (CID 58871037) is 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+).
What is the SMILES notation for 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+)?
The canonical SMILES for 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+) is [Pt+2].[c-]1ccccc1-c1[c-]c(-c2cccc(Sc3ccccn3)n2)ccc1.
What is the InChIKey of 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+)?
The InChIKey is JNTRSSAWINYKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14N2S.Pt/c1-2-8-17(9-3-1)18-10-6-11-19(16-18)20-12-7-14-22(24-20)25-21-13-4-5-15-23-21;/h1-8,10-15H;/q-2;+2.
What are the key properties of 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+)?
2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+) has a molecular weight of 533.51 g/mol, XLogP of 5.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-phenylbenzene-2-id-1-yl)-6-pyridin-2-ylsulfanylpyridine;platinum(2+) is sourced from PubChem (CID 58871037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).