C22H15N2OPtS- — CID 153304165
platinum;2-[6-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)-2-pyridinyl]phenol (PubChem CID 153304165) has the molecular formula C22H15N2OPtS- and a molecular weight of 550.52 g/mol. Its IUPAC name is platinum;2-[6-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)-2-pyridinyl]phenol.
| Compound Name | platinum;2-[6-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 153304165 |
| Molecular Formula | C22H15N2OPtS- |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | platinum;2-[6-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)-2-pyridinyl]phenol |
| SMILES | Oc1ccccc1-c1cccc(-c2[c-]c(Sc3ccccn3)ccc2)n1.[Pt] |
| InChI | InChI=1S/C22H15N2OS.Pt/c25-21-12-2-1-9-18(21)20-11-6-10-19(24-20)16-7-5-8-17(15-16)26-22-13-3-4-14-23-22;/h1-14,25H;/q-1; |
| InChIKey | FVNZKGVQJONBRS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|