C21H14N3OPtS- — CID 153280573
platinum;2-[2-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)pyrimidin-4-yl]phenol (PubChem CID 153280573) has the molecular formula C21H14N3OPtS- and a molecular weight of 551.51 g/mol. Its IUPAC name is platinum;2-[2-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)pyrimidin-4-yl]phenol.
| Compound Name | platinum;2-[2-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)pyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 153280573 |
| Molecular Formula | C21H14N3OPtS- |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | platinum;2-[2-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)pyrimidin-4-yl]phenol |
| SMILES | Oc1ccccc1-c1ccnc(-c2[c-]c(Sc3ccccn3)ccc2)n1.[Pt] |
| InChI | InChI=1S/C21H14N3OS.Pt/c25-19-9-2-1-8-17(19)18-11-13-23-21(24-18)15-6-5-7-16(14-15)26-20-10-3-4-12-22-20;/h1-13,25H;/q-1; |
| InChIKey | FGMYJVNVALFZEF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|