C39H42N3OPtS- — CID 153280348
2-[4-(3-tert-butyl-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl)-6-(3,5-ditert-butylphenyl)pyrimidin-2-yl]phenol;platinum (PubChem CID 153280348) has the molecular formula C39H42N3OPtS- and a molecular weight of 795.93 g/mol. Its IUPAC name is 2-[4-(3-tert-butyl-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl)-6-(3,5-ditert-butylphenyl)pyrimidin-2-yl]phenol;platinum.
| Compound Name | 2-[4-(3-tert-butyl-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl)-6-(3,5-ditert-butylphenyl)pyrimidin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280348 |
| Molecular Formula | C39H42N3OPtS- |
| Molecular Weight | 795.93 g/mol |
| Exact Mass | 795.27 |
| IUPAC Name | 2-[4-(3-tert-butyl-5-pyridin-2-ylsulfanylbenzene-6-id-1-yl)-6-(3,5-ditert-butylphenyl)pyrimidin-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(Sc2ccccn2)[c-]c(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)nc(-c3ccccc3O)n2)c1.[Pt] |
| InChI | InChI=1S/C39H42N3OS.Pt/c1-37(2,3)27-18-25(19-28(22-27)38(4,5)6)32-24-33(42-36(41-32)31-14-10-11-15-34(31)43)26-20-29(39(7,8)9)23-30(21-26)44-35-16-12-13-17-40-35;/h10-20,22-24,43H,1-9H3;/q-1; |
| InChIKey | YQBRTUDIYJNHGQ-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.93 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|