C26H23N2NiO- — CID 153499003
2-[4-tert-butyl-6-(3-pyridin-2-ylbenzene-2-id-1-yl)-2-pyridinyl]phenol;nickel (PubChem CID 153499003) has the molecular formula C26H23N2NiO- and a molecular weight of 438.18 g/mol. Its IUPAC name is 2-[4-tert-butyl-6-(3-pyridin-2-ylbenzene-2-id-1-yl)-2-pyridinyl]phenol;nickel.
| Compound Name | 2-[4-tert-butyl-6-(3-pyridin-2-ylbenzene-2-id-1-yl)-2-pyridinyl]phenol;nickel |
|---|---|
| PubChem CID | 153499003 |
| Molecular Formula | C26H23N2NiO- |
| Molecular Weight | 438.18 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-[4-tert-butyl-6-(3-pyridin-2-ylbenzene-2-id-1-yl)-2-pyridinyl]phenol;nickel |
| SMILES | CC(C)(C)c1cc(-c2[c-]c(-c3ccccn3)ccc2)nc(-c2ccccc2O)c1.[Ni] |
| InChI | InChI=1S/C26H23N2O.Ni/c1-26(2,3)20-16-23(28-24(17-20)21-11-4-5-13-25(21)29)19-10-8-9-18(15-19)22-12-6-7-14-27-22;/h4-14,16-17,29H,1-3H3;/q-1; |
| InChIKey | JCARNUOJSWQKDJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.18 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|