C54H46N3OPt- — CID 170542300
2-[4-(3,5-ditert-butylphenyl)-6-[3-[3-(9-phenylcarbazol-4-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 170542300) has the molecular formula C54H46N3OPt- and a molecular weight of 948.06 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-[3-[3-(9-phenylcarbazol-4-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[3-(9-phenylcarbazol-4-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 170542300 |
| Molecular Formula | C54H46N3OPt- |
| Molecular Weight | 948.06 g/mol |
| Exact Mass | 947.33 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[3-(9-phenylcarbazol-4-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3[c-]c(-c4ncccc4-c4cccc5c4c4ccccc4n5-c4ccccc4)ccc3)nc(-c3ccccc3O)c2)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C54H46N3O.Pt/c1-53(2,3)39-30-37(31-40(34-39)54(4,5)6)38-32-46(56-47(33-38)44-21-11-13-27-50(44)58)35-17-14-18-36(29-35)52-43(24-16-28-55-52)42-23-15-26-49-51(42)45-22-10-12-25-48(45)57(49)41-19-8-7-9-20-41;/h7-28,30-34,58H,1-6H3;/q-1; |
| InChIKey | BYAIVXSWSMORFY-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.06 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|