C52H44N3O2Pt- — CID 168803320
2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(4-phenylfuro[3,2-b]indol-5-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 168803320) has the molecular formula C52H44N3O2Pt- and a molecular weight of 938.02 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(4-phenylfuro[3,2-b]indol-5-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(4-phenylfuro[3,2-b]indol-5-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 168803320 |
| Molecular Formula | C52H44N3O2Pt- |
| Molecular Weight | 938.02 g/mol |
| Exact Mass | 937.31 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(4-phenylfuro[3,2-b]indol-5-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3[c-]c(-c4cc(-c5cccc6c7occc7n(-c7ccccc7)c56)ccn4)ccc3)nc(-c3ccccc3O)c2)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C52H44N3O2.Pt/c1-51(2,3)38-27-36(28-39(32-38)52(4,5)6)37-30-45(54-46(31-37)42-18-10-11-21-48(42)56)35-15-12-14-34(26-35)44-29-33(22-24-53-44)41-19-13-20-43-49(41)55(40-16-8-7-9-17-40)47-23-25-57-50(43)47;/h7-25,27-32,56H,1-6H3;/q-1; |
| InChIKey | AXWOWFPVLXGMHB-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.02 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|