C63H57N4OPt- — CID 170676723
2-[6-[3-[4-[9-[4-(5-tert-butyl-2-pyridinyl)phenyl]carbazol-1-yl]-2-pyridinyl]benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol;platinum (PubChem CID 170676723) has the molecular formula C63H57N4OPt- and a molecular weight of 1081.25 g/mol. Its IUPAC name is 2-[6-[3-[4-[9-[4-(5-tert-butyl-2-pyridinyl)phenyl]carbazol-1-yl]-2-pyridinyl]benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[6-[3-[4-[9-[4-(5-tert-butyl-2-pyridinyl)phenyl]carbazol-1-yl]-2-pyridinyl]benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 170676723 |
| Molecular Formula | C63H57N4OPt- |
| Molecular Weight | 1081.25 g/mol |
| Exact Mass | 1080.42 |
| IUPAC Name | 2-[6-[3-[4-[9-[4-(5-tert-butyl-2-pyridinyl)phenyl]carbazol-1-yl]-2-pyridinyl]benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-n3c4ccccc4c4cccc(-c5ccnc(-c6[c-]c(-c7cc(-c8cc(C(C)(C)C)cc(C(C)(C)C)c8)cc(-c8ccccc8O)n7)ccc6)c5)c43)cc2)nc1.[Pt] |
| InChI | InChI=1S/C63H57N4O.Pt/c1-61(2,3)46-26-29-54(65-39-46)40-24-27-49(28-25-40)67-58-22-12-10-18-51(58)52-21-15-20-50(60(52)67)41-30-31-64-55(35-41)42-16-14-17-43(32-42)56-36-45(37-57(66-56)53-19-11-13-23-59(53)68)44-33-47(62(4,5)6)38-48(34-44)63(7,8)9;/h10-31,33-39,68H,1-9H3;/q-1; |
| InChIKey | ZRORVQKGVLZZBQ-UHFFFAOYSA-N |
| XLogP | 16.37 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1081.25 |
| LogP ≤ 5 | 16.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|