C47H32N3OPt- — CID 176614283
5-methyl-2-[4-phenyl-6-[3-[4-(9-phenylcarbazol-1-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 176614283) has the molecular formula C47H32N3OPt- and a molecular weight of 849.87 g/mol. Its IUPAC name is 5-methyl-2-[4-phenyl-6-[3-[4-(9-phenylcarbazol-1-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 5-methyl-2-[4-phenyl-6-[3-[4-(9-phenylcarbazol-1-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 176614283 |
| Molecular Formula | C47H32N3OPt- |
| Molecular Weight | 849.87 g/mol |
| Exact Mass | 849.22 |
| IUPAC Name | 5-methyl-2-[4-phenyl-6-[3-[4-(9-phenylcarbazol-1-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)cc(-c3[c-]c(-c4cc(-c5cccc6c7ccccc7n(-c7ccccc7)c56)ccn4)ccc3)n2)c(O)c1.[Pt] |
| InChI | InChI=1S/C47H32N3O.Pt/c1-31-22-23-41(46(51)26-31)44-30-36(32-12-4-2-5-13-32)29-43(49-44)35-15-10-14-34(27-35)42-28-33(24-25-48-42)38-19-11-20-40-39-18-8-9-21-45(39)50(47(38)40)37-16-6-3-7-17-37;/h2-26,28-30,51H,1H3;/q-1; |
| InChIKey | BFFBCUBWMLRMGW-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.87 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|