C53H45N4OPt- — CID 168803422
2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(9-phenylpyrido[3,4-b]indol-8-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 168803422) has the molecular formula C53H45N4OPt- and a molecular weight of 949.05 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(9-phenylpyrido[3,4-b]indol-8-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(9-phenylpyrido[3,4-b]indol-8-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 168803422 |
| Molecular Formula | C53H45N4OPt- |
| Molecular Weight | 949.05 g/mol |
| Exact Mass | 948.32 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(9-phenylpyrido[3,4-b]indol-8-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3[c-]c(-c4cc(-c5cccc6c7ccncc7n(-c7ccccc7)c56)ccn4)ccc3)nc(-c3ccccc3O)c2)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C53H45N4O.Pt/c1-52(2,3)39-27-37(28-40(32-39)53(4,5)6)38-30-47(56-48(31-38)45-18-10-11-21-50(45)58)36-15-12-14-35(26-36)46-29-34(22-25-55-46)42-19-13-20-44-43-23-24-54-33-49(43)57(51(42)44)41-16-8-7-9-17-41;/h7-25,27-33,58H,1-6H3;/q-1; |
| InChIKey | GCVHIQNGFFHYKZ-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.05 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|