C55H48N3OPt- — CID 168803349
2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(2-methyl-9-phenylcarbazol-1-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 168803349) has the molecular formula C55H48N3OPt- and a molecular weight of 962.09 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(2-methyl-9-phenylcarbazol-1-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(2-methyl-9-phenylcarbazol-1-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 168803349 |
| Molecular Formula | C55H48N3OPt- |
| Molecular Weight | 962.09 g/mol |
| Exact Mass | 961.35 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(2-methyl-9-phenylcarbazol-1-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | Cc1ccc2c3ccccc3n(-c3ccccc3)c2c1-c1ccnc(-c2[c-]c(-c3cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc(-c4ccccc4O)n3)ccc2)c1.[Pt] |
| InChI | InChI=1S/C55H48N3O.Pt/c1-35-24-25-45-44-20-11-13-22-50(44)58(43-18-9-8-10-19-43)53(45)52(35)38-26-27-56-47(31-38)36-16-15-17-37(28-36)48-32-40(33-49(57-48)46-21-12-14-23-51(46)59)39-29-41(54(2,3)4)34-42(30-39)55(5,6)7;/h8-27,29-34,59H,1-7H3;/q-1; |
| InChIKey | HTAKMJXTDGZLSP-UHFFFAOYSA-N |
| XLogP | 14.32 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.09 |
| LogP ≤ 5 | 14.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|