C63H52N3O2Pt- — CID 170524268
2-[6-[3-[4-(3-dibenzofuran-3-yl-1-phenylindol-2-yl)-6-methyl-2-pyridinyl]benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol;platinum (PubChem CID 170524268) has the molecular formula C63H52N3O2Pt- and a molecular weight of 1078.21 g/mol. Its IUPAC name is 2-[6-[3-[4-(3-dibenzofuran-3-yl-1-phenylindol-2-yl)-6-methyl-2-pyridinyl]benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[6-[3-[4-(3-dibenzofuran-3-yl-1-phenylindol-2-yl)-6-methyl-2-pyridinyl]benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 170524268 |
| Molecular Formula | C63H52N3O2Pt- |
| Molecular Weight | 1078.21 g/mol |
| Exact Mass | 1077.37 |
| IUPAC Name | 2-[6-[3-[4-(3-dibenzofuran-3-yl-1-phenylindol-2-yl)-6-methyl-2-pyridinyl]benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol;platinum |
| SMILES | Cc1cc(-c2c(-c3ccc4c(c3)oc3ccccc34)c3ccccc3n2-c2ccccc2)cc(-c2[c-]c(-c3cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc(-c4ccccc4O)n3)ccc2)n1.[Pt] |
| InChI | InChI=1S/C63H52N3O2.Pt/c1-39-30-45(61-60(42-28-29-50-49-22-13-16-27-58(49)68-59(50)37-42)52-24-11-14-25-56(52)66(61)48-20-9-8-10-21-48)36-53(64-39)40-18-17-19-41(31-40)54-34-44(35-55(65-54)51-23-12-15-26-57(51)67)43-32-46(62(2,3)4)38-47(33-43)63(5,6)7;/h8-30,32-38,67H,1-7H3;/q-1; |
| InChIKey | STCRZJKHJDUOKN-UHFFFAOYSA-N |
| XLogP | 16.73 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1078.21 |
| LogP ≤ 5 | 16.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|