C55H35N2O3Pt- — CID 170524468
2-[6-[3-[6-methyl-4-[3-(6-phenyldibenzofuran-3-yl)-1-benzofuran-2-yl]-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum (PubChem CID 170524468) has the molecular formula C55H35N2O3Pt- and a molecular weight of 966.97 g/mol. Its IUPAC name is 2-[6-[3-[6-methyl-4-[3-(6-phenyldibenzofuran-3-yl)-1-benzofuran-2-yl]-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[6-[3-[6-methyl-4-[3-(6-phenyldibenzofuran-3-yl)-1-benzofuran-2-yl]-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 170524468 |
| Molecular Formula | C55H35N2O3Pt- |
| Molecular Weight | 966.97 g/mol |
| Exact Mass | 966.23 |
| IUPAC Name | 2-[6-[3-[6-methyl-4-[3-(6-phenyldibenzofuran-3-yl)-1-benzofuran-2-yl]-2-pyridinyl]benzene-2-id-1-yl]-4-phenyl-2-pyridinyl]phenol;platinum |
| SMILES | Cc1cc(-c2oc3ccccc3c2-c2ccc3c(c2)oc2c(-c4ccccc4)cccc23)cc(-c2[c-]c(-c3cc(-c4ccccc4)cc(-c4ccccc4O)n3)ccc2)n1.[Pt] |
| InChI | InChI=1S/C55H35N2O3.Pt/c1-34-28-41(32-47(56-34)37-18-12-19-38(29-37)48-30-40(35-14-4-2-5-15-35)31-49(57-48)45-20-8-10-24-50(45)58)54-53(46-21-9-11-25-51(46)59-54)39-26-27-43-44-23-13-22-42(36-16-6-3-7-17-36)55(44)60-52(43)33-39;/h2-28,30-33,58H,1H3;/q-1; |
| InChIKey | UOCRWROZUFOSDL-UHFFFAOYSA-N |
| XLogP | 14.60 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.97 |
| LogP ≤ 5 | 14.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|