C58H51N2O2Pt- — CID 170524337
2-[6-[3-(4-dibenzofuran-4-yl-6-methyl-2-pyridinyl)benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]-9,9-dimethylfluoren-3-ol;platinum (PubChem CID 170524337) has the molecular formula C58H51N2O2Pt- and a molecular weight of 1003.14 g/mol. Its IUPAC name is 2-[6-[3-(4-dibenzofuran-4-yl-6-methyl-2-pyridinyl)benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]-9,9-dimethylfluoren-3-ol;platinum.
| Compound Name | 2-[6-[3-(4-dibenzofuran-4-yl-6-methyl-2-pyridinyl)benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]-9,9-dimethylfluoren-3-ol;platinum |
|---|---|
| PubChem CID | 170524337 |
| Molecular Formula | C58H51N2O2Pt- |
| Molecular Weight | 1003.14 g/mol |
| Exact Mass | 1002.36 |
| IUPAC Name | 2-[6-[3-(4-dibenzofuran-4-yl-6-methyl-2-pyridinyl)benzene-2-id-1-yl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]-9,9-dimethylfluoren-3-ol;platinum |
| SMILES | Cc1cc(-c2cccc3c2oc2ccccc23)cc(-c2[c-]c(-c3cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc(-c4cc5c(cc4O)-c4ccccc4C5(C)C)n3)ccc2)n1.[Pt] |
| InChI | InChI=1S/C58H51N2O2.Pt/c1-34-24-39(42-20-15-21-45-44-19-11-13-23-54(44)62-55(42)45)30-50(59-34)35-16-14-17-36(25-35)51-28-38(37-26-40(56(2,3)4)31-41(27-37)57(5,6)7)29-52(60-51)47-32-49-46(33-53(47)61)43-18-10-12-22-48(43)58(49,8)9;/h10-24,26-33,61H,1-9H3;/q-1; |
| InChIKey | IOTKUXAWXOEJAV-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.14 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|